C22H28N2O3 — CID 163023492
[(1R,2S,4S,9R,10R)-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] benzoate (PubChem CID 163023492) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is [(1R,2S,4S,9R,10R)-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] benzoate.
| Compound Name | [(1R,2S,4S,9R,10R)-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 163023492 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [(1R,2S,4S,9R,10R)-14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-4-yl] benzoate |
| SMILES | O=C(O[C@H]1CCN2C[C@H]3C[C@H](CN4C(=O)CCC[C@H]34)[C@@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O3/c25-21-8-4-7-19-16-11-17(14-24(19)21)20-12-18(9-10-23(20)13-16)27-22(26)15-5-2-1-3-6-15/h1-3,5-6,16-20H,4,7-14H2/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | QFVFKNNOHLGRBN-OBKDMQGPSA-N |
| XLogP | 2.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |