C32H44O6 — CID 163023603
[3-methyl-2-oxo-8-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-1,6-dioxaspiro[4.4]non-3-en-7-yl] acetate (PubChem CID 163023603) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is [3-methyl-2-oxo-8-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-1,6-dioxaspiro[4.4]non-3-en-7-yl] acetate.
| Compound Name | [3-methyl-2-oxo-8-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-1,6-dioxaspiro[4.4]non-3-en-7-yl] acetate |
|---|---|
| PubChem CID | 163023603 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | [3-methyl-2-oxo-8-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-1,6-dioxaspiro[4.4]non-3-en-7-yl] acetate |
| SMILES | CC(=O)OC1OC2(C=C(C)C(=O)O2)CC1C1CCC2(C)C3=C(CCC12C)C1(C)CCC(=O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C32H44O6/c1-18-16-32(37-26(18)35)17-20(27(38-32)36-19(2)33)21-10-14-31(7)23-8-9-24-28(3,4)25(34)12-13-29(24,5)22(23)11-15-30(21,31)6/h16,20-21,24,27H,8-15,17H2,1-7H3 |
| InChIKey | BONUUNVHRUYPDW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|