C22H39NO2 — CID 163023630
1-pyrrolidin-1-yloctadec-2-ene-1,12-dione (PubChem CID 163023630) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is 1-pyrrolidin-1-yloctadec-2-ene-1,12-dione.
| Compound Name | 1-pyrrolidin-1-yloctadec-2-ene-1,12-dione |
|---|---|
| PubChem CID | 163023630 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | 1-pyrrolidin-1-yloctadec-2-ene-1,12-dione |
| SMILES | CCCCCCC(=O)CCCCCCCCC=CC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H39NO2/c1-2-3-4-11-16-21(24)17-12-9-7-5-6-8-10-13-18-22(25)23-19-14-15-20-23/h13,18H,2-12,14-17,19-20H2,1H3 |
| InChIKey | PKNHPNCVMGDUJC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|