C52H60N10O14S2 — CID 163023759
CID 163023759 (PubChem CID 163023759) has the molecular formula C52H60N10O14S2 and a molecular weight of 1113.24 g/mol.
| Compound Name | CID 163023759 |
|---|---|
| PubChem CID | 163023759 |
| Molecular Formula | C52H60N10O14S2 |
| Molecular Weight | 1113.24 g/mol |
| Exact Mass | 1112.37 |
| IUPAC Name | — |
| SMILES | C[C@@H]1NC(=O)[C@@H](NC(=O)c2nc3ccccc3cc2O)COC(=O)[C@]2(C[C@@H]2C)N(C)C(=O)[C@@H]2CSSC[C@@H](C(=O)N(C)[C@@]3(C[C@@H]3C)C(=O)OC[C@@H](NC(=O)c3nc4ccccc4cc3O)C(=O)N[C@@H](C)C(=O)N2C)N(C)C1=O |
| InChI | InChI=1S/C52H60N10O14S2/c1-25-19-51(25)49(73)75-21-33(57-43(67)39-37(63)17-29-13-9-11-15-31(29)55-39)41(65)53-28(4)46(70)60(6)36-24-78-77-23-35(47(71)61(51)7)59(5)45(69)27(3)54-42(66)34(22-76-50(74)52(20-26(52)2)62(8)48(36)72)58-44(68)40-38(64)18-30-14-10-12-16-32(30)56-40/h9-18,25-28,33-36,63-64H,19-24H2,1-8H3,(H,53,65)(H,54,66)(H,57,67)(H,58,68)/t25-,26-,27-,28-,33-,34+,35-,36-,51+,52+/m0/s1 |
| InChIKey | LWKICZFLUHYJAT-NAOZTRTISA-N |
| XLogP | 0.72 |
| TPSA | 316.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|