C32H44O2 — CID 163023816
(1'S,3R,3aR,6E,7'S,10E,14E,15aS)-1',6,7',10,14-pentamethylspiro[3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3,10'-tricyclo[7.2.1.02,8]dodeca-2(8),3-diene]-2-one (PubChem CID 163023816) has the molecular formula C32H44O2 and a molecular weight of 460.70 g/mol. Its IUPAC name is (1'S,3R,3aR,6E,7'S,10E,14E,15aS)-1',6,7',10,14-pentamethylspiro[3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3,10'-tricyclo[7.2.1.02,8]dodeca-2(8),3-diene]-2-one.
| Compound Name | (1'S,3R,3aR,6E,7'S,10E,14E,15aS)-1',6,7',10,14-pentamethylspiro[3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3,10'-tricyclo[7.2.1.02,8]dodeca-2(8),3-diene]-2-one |
|---|---|
| PubChem CID | 163023816 |
| Molecular Formula | C32H44O2 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | (1'S,3R,3aR,6E,7'S,10E,14E,15aS)-1',6,7',10,14-pentamethylspiro[3a,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-3,10'-tricyclo[7.2.1.02,8]dodeca-2(8),3-diene]-2-one |
| SMILES | C/C1=C\CC/C(C)=C/[C@@H]2OC(=O)[C@@]3(C[C@]4(C)CC3C3=C4C=CCC[C@@H]3C)[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C32H44O2/c1-21-10-8-12-22(2)16-17-25-28(18-23(3)13-9-11-21)34-30(33)32(25)20-31(5)19-27(32)29-24(4)14-6-7-15-26(29)31/h7,11-12,15,18,24-25,27-28H,6,8-10,13-14,16-17,19-20H2,1-5H3/b21-11+,22-12+,23-18+/t24-,25-,27?,28-,31-,32-/m0/s1 |
| InChIKey | KPWCVKYYCMRAQY-LMCLSQPGSA-N |
| XLogP | 8.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|