C11H18O6 — CID 163024462
[(2S)-2,3-dihydroxypropyl] (2E,4S,5R,6E)-4,5-dihydroxyocta-2,6-dienoate (PubChem CID 163024462) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] (2E,4S,5R,6E)-4,5-dihydroxyocta-2,6-dienoate.
| Compound Name | [(2S)-2,3-dihydroxypropyl] (2E,4S,5R,6E)-4,5-dihydroxyocta-2,6-dienoate |
|---|---|
| PubChem CID | 163024462 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] (2E,4S,5R,6E)-4,5-dihydroxyocta-2,6-dienoate |
| SMILES | C/C=C/[C@@H](O)[C@@H](O)/C=C/C(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C11H18O6/c1-2-3-9(14)10(15)4-5-11(16)17-7-8(13)6-12/h2-5,8-10,12-15H,6-7H2,1H3/b3-2+,5-4+/t8-,9+,10-/m0/s1 |
| InChIKey | ZNTNUBKHLXBEIN-PDVDVHGDSA-N |
| XLogP | -1.26 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|