C17H22O4 — CID 163024506
(1a,2-diformyl-5,5,6b-trimethyl-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]inden-4-yl) acetate (PubChem CID 163024506) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1a,2-diformyl-5,5,6b-trimethyl-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]inden-4-yl) acetate.
| Compound Name | (1a,2-diformyl-5,5,6b-trimethyl-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]inden-4-yl) acetate |
|---|---|
| PubChem CID | 163024506 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1a,2-diformyl-5,5,6b-trimethyl-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]inden-4-yl) acetate |
| SMILES | CC(=O)OC1C2C=C(C=O)C3(C=O)CC3(C)C2CC1(C)C |
| InChI | InChI=1S/C17H22O4/c1-10(20)21-14-12-5-11(7-18)17(9-19)8-16(17,4)13(12)6-15(14,2)3/h5,7,9,12-14H,6,8H2,1-4H3 |
| InChIKey | XEVZGDZYMOUHQH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|