About (2-amino-3-methylphenyl) formate
(2-amino-3-methylphenyl) formate (PubChem CID 163024542) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is (2-amino-3-methylphenyl) formate.
Molecular Properties
| Compound Name | (2-amino-3-methylphenyl) formate |
| PubChem CID | 163024542 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (2-amino-3-methylphenyl) formate |
| SMILES | Cc1cccc(OC=O)c1N |
| InChI | InChI=1S/C8H9NO2/c1-6-3-2-4-7(8(6)9)11-5-10/h2-5H,9H2,1H3 |
| InChIKey | PYEMETQKMKPNSV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-3-methylphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-methylphenyl) formate?
The IUPAC name of (2-amino-3-methylphenyl) formate (CID 163024542) is (2-amino-3-methylphenyl) formate.
What is the SMILES notation for (2-amino-3-methylphenyl) formate?
The canonical SMILES for (2-amino-3-methylphenyl) formate is Cc1cccc(OC=O)c1N.
What is the InChIKey of (2-amino-3-methylphenyl) formate?
The InChIKey is PYEMETQKMKPNSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-6-3-2-4-7(8(6)9)11-5-10/h2-5H,9H2,1H3.
What are the key properties of (2-amino-3-methylphenyl) formate?
(2-amino-3-methylphenyl) formate has a molecular weight of 151.16 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-methylphenyl) formate is sourced from PubChem (CID 163024542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).