C18H22O7 — CID 163024681
5,10-dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.6.1.02,4.06,16.011,15]hexadec-11(15)-ene-7,14-dione (PubChem CID 163024681) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is 5,10-dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.6.1.02,4.06,16.011,15]hexadec-11(15)-ene-7,14-dione.
| Compound Name | 5,10-dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.6.1.02,4.06,16.011,15]hexadec-11(15)-ene-7,14-dione |
|---|---|
| PubChem CID | 163024681 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5,10-dihydroxy-1,6-dimethyl-12-propan-2-yl-3,8,13-trioxapentacyclo[7.6.1.02,4.06,16.011,15]hexadec-11(15)-ene-7,14-dione |
| SMILES | CC(C)C1OC(=O)C2=C1C(O)C1OC(=O)C3(C)C(O)C4OC4C2(C)C13 |
| InChI | InChI=1S/C18H22O7/c1-5(2)9-6-7(15(21)24-9)17(3)12-10(8(6)19)25-16(22)18(12,4)13(20)11-14(17)23-11/h5,8-14,19-20H,1-4H3 |
| InChIKey | KCVQSKNIJWXQDJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|