C15H24O4 — CID 163024742
(6S,7E,10S)-6-hydroperoxy-10-hydroxy-2,6,10-trimethyldodeca-2,7,11-trien-4-one (PubChem CID 163024742) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (6S,7E,10S)-6-hydroperoxy-10-hydroxy-2,6,10-trimethyldodeca-2,7,11-trien-4-one.
| Compound Name | (6S,7E,10S)-6-hydroperoxy-10-hydroxy-2,6,10-trimethyldodeca-2,7,11-trien-4-one |
|---|---|
| PubChem CID | 163024742 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (6S,7E,10S)-6-hydroperoxy-10-hydroxy-2,6,10-trimethyldodeca-2,7,11-trien-4-one |
| SMILES | C=C[C@@](C)(O)C/C=C/[C@](C)(CC(=O)C=C(C)C)OO |
| InChI | InChI=1S/C15H24O4/c1-6-14(4,17)8-7-9-15(5,19-18)11-13(16)10-12(2)3/h6-7,9-10,17-18H,1,8,11H2,2-5H3/b9-7+/t14-,15-/m1/s1 |
| InChIKey | VKKZYMLSLLRWLW-VIGJRRFGSA-N |
| XLogP | 3.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|