C15H16O6 — CID 163025067
(1R,2R,6S,7Z,9S,11S)-9,11-dihydroxy-8-methyl-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione (PubChem CID 163025067) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is (1R,2R,6S,7Z,9S,11S)-9,11-dihydroxy-8-methyl-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione.
| Compound Name | (1R,2R,6S,7Z,9S,11S)-9,11-dihydroxy-8-methyl-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione |
|---|---|
| PubChem CID | 163025067 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (1R,2R,6S,7Z,9S,11S)-9,11-dihydroxy-8-methyl-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione |
| SMILES | C=C1C(=O)O[C@H]2/C=C(/C)[C@@H](O)C[C@H](O)C3=C[C@@H](OC3=O)[C@H]12 |
| InChI | InChI=1S/C15H16O6/c1-6-3-11-13(7(2)14(18)20-11)12-4-8(15(19)21-12)10(17)5-9(6)16/h3-4,9-13,16-17H,2,5H2,1H3/b6-3-/t9-,10-,11-,12+,13+/m0/s1 |
| InChIKey | GAIBNVSLQBBBBK-LXRYSYBESA-N |
| XLogP | 0.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|