C15H20O3 — CID 163026020
(1S,4Z,8E)-4,8,12-trimethyl-2,14-dioxabicyclo[9.3.0]tetradeca-4,8,11-trien-13-one (PubChem CID 163026020) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,4Z,8E)-4,8,12-trimethyl-2,14-dioxabicyclo[9.3.0]tetradeca-4,8,11-trien-13-one.
| Compound Name | (1S,4Z,8E)-4,8,12-trimethyl-2,14-dioxabicyclo[9.3.0]tetradeca-4,8,11-trien-13-one |
|---|---|
| PubChem CID | 163026020 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,4Z,8E)-4,8,12-trimethyl-2,14-dioxabicyclo[9.3.0]tetradeca-4,8,11-trien-13-one |
| SMILES | CC1=C2C/C=C(\C)CC/C=C(/C)CO[C@H]2OC1=O |
| InChI | InChI=1S/C15H20O3/c1-10-5-4-6-11(2)9-17-15-13(8-7-10)12(3)14(16)18-15/h6-7,15H,4-5,8-9H2,1-3H3/b10-7+,11-6-/t15-/m0/s1 |
| InChIKey | CJMJPQQIHVKOOH-BZYOMVPBSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|