C22H25NO — CID 163026117
2-[(2R)-1-ethyl-2-methylpyrrolidin-3-ylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-6-ol (PubChem CID 163026117) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[(2R)-1-ethyl-2-methylpyrrolidin-3-ylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-6-ol.
| Compound Name | 2-[(2R)-1-ethyl-2-methylpyrrolidin-3-ylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-6-ol |
|---|---|
| PubChem CID | 163026117 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-[(2R)-1-ethyl-2-methylpyrrolidin-3-ylidene]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-6-ol |
| SMILES | CCN1CCC(=C2c3ccccc3CCc3cc(O)ccc32)[C@H]1C |
| InChI | InChI=1S/C22H25NO/c1-3-23-13-12-19(15(23)2)22-20-7-5-4-6-16(20)8-9-17-14-18(24)10-11-21(17)22/h4-7,10-11,14-15,24H,3,8-9,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | YBBDKUSKFPWNCC-OAHLLOKOSA-N |
| XLogP | 4.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|