C24H44O12 — CID 163026700
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1S,4S,5R)-4-[(3S)-4-hydroxy-3-[(2R,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxybutyl]-3,3,5-trimethylcyclohexyl]oxyoxane-3,4,5-triol (PubChem CID 163026700) has the molecular formula C24H44O12 and a molecular weight of 524.60 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1S,4S,5R)-4-[(3S)-4-hydroxy-3-[(2R,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxybutyl]-3,3,5-trimethylcyclohexyl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1S,4S,5R)-4-[(3S)-4-hydroxy-3-[(2R,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxybutyl]-3,3,5-trimethylcyclohexyl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 163026700 |
| Molecular Formula | C24H44O12 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1S,4S,5R)-4-[(3S)-4-hydroxy-3-[(2R,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxybutyl]-3,3,5-trimethylcyclohexyl]oxyoxane-3,4,5-triol |
| SMILES | C[C@@H]1C[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC(C)(C)[C@H]1CC[C@@H](CO)O[C@H]1OC[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H44O12/c1-11-6-13(35-23-21(32)19(30)18(29)16(9-26)36-23)7-24(2,3)14(11)5-4-12(8-25)34-22-20(31)17(28)15(27)10-33-22/h11-23,25-32H,4-10H2,1-3H3/t11-,12+,13+,14+,15+,16-,17+,18-,19+,20+,21-,22-,23-/m1/s1 |
| InChIKey | GWLFSUPWPHIRQN-GRMKGYBTSA-N |
| XLogP | -2.16 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |