C36H45N3O4 — CID 163027573
(1R,2S,7S,10R,13R,15R)-13-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol (PubChem CID 163027573) has the molecular formula C36H45N3O4 and a molecular weight of 583.77 g/mol. Its IUPAC name is (1R,2S,7S,10R,13R,15R)-13-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol.
| Compound Name | (1R,2S,7S,10R,13R,15R)-13-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol |
|---|---|
| PubChem CID | 163027573 |
| Molecular Formula | C36H45N3O4 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | (1R,2S,7S,10R,13R,15R)-13-[3-[(3S)-3-(2-amino-4-pyridinyl)-4-(1H-pyrrol-2-yl)butoxy]-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol |
| SMILES | CC[C@@H]1C#C[C@@H]2C=C[C@H](c3ccc(O)c(OCC[C@H](Cc4ccc[nH]4)c4ccnc(N)c4)c3)C[C@@H](O)[C@H]2[C@@H](O)CCCC1 |
| InChI | InChI=1S/C36H45N3O4/c1-2-24-6-3-4-8-32(41)36-25(10-9-24)11-12-26(21-33(36)42)27-13-14-31(40)34(22-27)43-19-16-29(20-30-7-5-17-38-30)28-15-18-39-35(37)23-28/h5,7,11-15,17-18,22-26,29,32-33,36,38,40-42H,2-4,6,8,16,19-21H2,1H3,(H2,37,39)/t24-,25+,26-,29+,32-,33+,36+/m0/s1 |
| InChIKey | QEXZXPDZRRRGGL-OATSMFHZSA-N |
| XLogP | 6.09 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|