C27H34O4 — CID 163027578
2-[(2E,6E,10Z)-3,7-dimethyl-10-[(6R)-2-oxo-6-prop-1-en-2-yloxan-3-ylidene]deca-2,6-dienyl]-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 163027578) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[(2E,6E,10Z)-3,7-dimethyl-10-[(6R)-2-oxo-6-prop-1-en-2-yloxan-3-ylidene]deca-2,6-dienyl]-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E,6E,10Z)-3,7-dimethyl-10-[(6R)-2-oxo-6-prop-1-en-2-yloxan-3-ylidene]deca-2,6-dienyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 163027578 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[(2E,6E,10Z)-3,7-dimethyl-10-[(6R)-2-oxo-6-prop-1-en-2-yloxan-3-ylidene]deca-2,6-dienyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=C(C)[C@H]1CC/C(=C/CC/C(C)=C/CC/C(C)=C/CC2=CC(=O)C=C(C)C2=O)C(=O)O1 |
| InChI | InChI=1S/C27H34O4/c1-18(2)25-15-14-22(27(30)31-25)11-7-10-19(3)8-6-9-20(4)12-13-23-17-24(28)16-21(5)26(23)29/h8,11-12,16-17,25H,1,6-7,9-10,13-15H2,2-5H3/b19-8+,20-12+,22-11-/t25-/m1/s1 |
| InChIKey | QLPPFXAWHWHPOA-YYKMCKDXSA-N |
| XLogP | 6.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|