C16H24O2 — CID 163027643
(4aR,8aR,9aS)-9a-methoxy-3,8a-dimethyl-2-methylidene-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1]benzofuran (PubChem CID 163027643) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (4aR,8aR,9aS)-9a-methoxy-3,8a-dimethyl-2-methylidene-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1]benzofuran.
| Compound Name | (4aR,8aR,9aS)-9a-methoxy-3,8a-dimethyl-2-methylidene-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1]benzofuran |
|---|---|
| PubChem CID | 163027643 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (4aR,8aR,9aS)-9a-methoxy-3,8a-dimethyl-2-methylidene-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1]benzofuran |
| SMILES | C=C1O[C@@]2(OC)C[C@@]3(C)CCCC[C@@H]3CC2=C1C |
| InChI | InChI=1S/C16H24O2/c1-11-12(2)18-16(17-4)10-15(3)8-6-5-7-13(15)9-14(11)16/h13H,2,5-10H2,1,3-4H3/t13-,15-,16+/m1/s1 |
| InChIKey | PVXKCPHTCXVMAV-BMFZPTHFSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |