C24H26O6 — CID 163027817
2-tert-butyl-4,6,9-trihydroxy-11-(3-methylbut-2-enyl)-2,3-dihydrofuro[3,2-b]xanthen-5-one (PubChem CID 163027817) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-tert-butyl-4,6,9-trihydroxy-11-(3-methylbut-2-enyl)-2,3-dihydrofuro[3,2-b]xanthen-5-one.
| Compound Name | 2-tert-butyl-4,6,9-trihydroxy-11-(3-methylbut-2-enyl)-2,3-dihydrofuro[3,2-b]xanthen-5-one |
|---|---|
| PubChem CID | 163027817 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-tert-butyl-4,6,9-trihydroxy-11-(3-methylbut-2-enyl)-2,3-dihydrofuro[3,2-b]xanthen-5-one |
| SMILES | CC(C)=CCc1c2c(c(O)c3c(=O)c4c(O)ccc(O)c4oc13)CC(C(C)(C)C)O2 |
| InChI | InChI=1S/C24H26O6/c1-11(2)6-7-12-21-13(10-16(29-21)24(3,4)5)19(27)18-20(28)17-14(25)8-9-15(26)23(17)30-22(12)18/h6,8-9,16,25-27H,7,10H2,1-5H3 |
| InChIKey | DRLYFKUSNMYYFW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|