C16H20O6 — CID 163027838
(1R,5R,10S,14R)-5,14-dihydroxy-2,11-dioxatricyclo[12.4.0.05,10]octadeca-6,15-diene-8,17-dione (PubChem CID 163027838) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (1R,5R,10S,14R)-5,14-dihydroxy-2,11-dioxatricyclo[12.4.0.05,10]octadeca-6,15-diene-8,17-dione.
| Compound Name | (1R,5R,10S,14R)-5,14-dihydroxy-2,11-dioxatricyclo[12.4.0.05,10]octadeca-6,15-diene-8,17-dione |
|---|---|
| PubChem CID | 163027838 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (1R,5R,10S,14R)-5,14-dihydroxy-2,11-dioxatricyclo[12.4.0.05,10]octadeca-6,15-diene-8,17-dione |
| SMILES | O=C1C=C[C@]2(O)CCO[C@@H]3CC(=O)C=C[C@]3(O)CCO[C@H]2C1 |
| InChI | InChI=1S/C16H20O6/c17-11-1-3-15(19)5-7-22-14-10-12(18)2-4-16(14,20)6-8-21-13(15)9-11/h1-4,13-14,19-20H,5-10H2/t13-,14+,15-,16-/m0/s1 |
| InChIKey | CLHSTVDCPKSBRC-FZKCQIBNSA-N |
| XLogP | 0.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |