C32H54O — CID 163028274
(2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]oxirane (PubChem CID 163028274) has the molecular formula C32H54O and a molecular weight of 454.78 g/mol. Its IUPAC name is (2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]oxirane.
| Compound Name | (2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]oxirane |
|---|---|
| PubChem CID | 163028274 |
| Molecular Formula | C32H54O |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | (2R,3R)-2-[(3R)-3,8-dimethyl-4-methylidenenon-7-enyl]-2-methyl-3-[(3E,7E,11S)-4,8,11,12-tetramethyltrideca-3,7,12-trienyl]oxirane |
| SMILES | C=C(CCC=C(C)C)[C@H](C)CC[C@@]1(C)O[C@@H]1CC/C=C(\C)CC/C=C(\C)CC[C@H](C)C(=C)C |
| InChI | InChI=1S/C32H54O/c1-24(2)14-11-18-29(8)30(9)22-23-32(10)31(33-32)19-13-17-26(5)15-12-16-27(6)20-21-28(7)25(3)4/h14,16-17,28,30-31H,3,8,11-13,15,18-23H2,1-2,4-7,9-10H3/b26-17+,27-16+/t28-,30+,31+,32+/m0/s1 |
| InChIKey | XFJKLZZPGOOEIU-PGFHKUAVSA-N |
| XLogP | 10.31 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|