C12H4F17NO4 — CID 163028310
2-cyanoethyl (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate (PubChem CID 163028310) has the molecular formula C12H4F17NO4 and a molecular weight of 549.13 g/mol. Its IUPAC name is 2-cyanoethyl (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate.
| Compound Name | 2-cyanoethyl (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 163028310 |
| Molecular Formula | C12H4F17NO4 |
| Molecular Weight | 549.13 g/mol |
| Exact Mass | 548.99 |
| IUPAC Name | 2-cyanoethyl (2R)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
| SMILES | N#CCCOC(=O)[C@](F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H4F17NO4/c13-5(8(17,18)19,4(31)32-3-1-2-30)33-12(28,29)7(16,10(23,24)25)34-11(26,27)6(14,15)9(20,21)22/h1,3H2/t5-,7-/m0/s1 |
| InChIKey | WFGHRIYBRFGZCW-FSPLSTOPSA-N |
| XLogP | 5.32 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.13 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|