C21H28O6 — CID 163028954
[(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (3R)-4-hydroxy-3-methoxy-2-methylidenebutanoate (PubChem CID 163028954) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is [(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (3R)-4-hydroxy-3-methoxy-2-methylidenebutanoate.
| Compound Name | [(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (3R)-4-hydroxy-3-methoxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 163028954 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (3R)-4-hydroxy-3-methoxy-2-methylidenebutanoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)C[C@@H](OC(=O)C(=C)[C@H](CO)OC)[C@@H]12 |
| InChI | InChI=1S/C21H28O6/c1-12-7-6-8-13(2)10-17-19(15(4)21(24)27-17)16(9-12)26-20(23)14(3)18(11-22)25-5/h7,10,16-19,22H,3-4,6,8-9,11H2,1-2,5H3/b12-7+,13-10+/t16-,17-,18+,19-/m1/s1 |
| InChIKey | YPQOLUGHCAWRBO-SZHMCISUSA-N |
| XLogP | 2.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|