C20H32O6 — CID 163028973
2,5,11,14-tetramethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione (PubChem CID 163028973) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 2,5,11,14-tetramethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione.
| Compound Name | 2,5,11,14-tetramethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione |
|---|---|
| PubChem CID | 163028973 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2,5,11,14-tetramethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione |
| SMILES | CC1CC2CCC(O2)C(C)C(=O)OC(C)CC2CCC(O2)C(C)C(=O)O1 |
| InChI | InChI=1S/C20H32O6/c1-11-9-15-5-7-18(25-15)14(4)20(22)24-12(2)10-16-6-8-17(26-16)13(3)19(21)23-11/h11-18H,5-10H2,1-4H3 |
| InChIKey | PQDLJCPCZJBEBP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |