C20H24O6 — CID 163029111
4-[(4S,6S)-6-hydroperoxy-4-hydroxy-3,7-dimethylocta-2,7-dienoxy]-5-methylchromen-2-one (PubChem CID 163029111) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[(4S,6S)-6-hydroperoxy-4-hydroxy-3,7-dimethylocta-2,7-dienoxy]-5-methylchromen-2-one.
| Compound Name | 4-[(4S,6S)-6-hydroperoxy-4-hydroxy-3,7-dimethylocta-2,7-dienoxy]-5-methylchromen-2-one |
|---|---|
| PubChem CID | 163029111 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-[(4S,6S)-6-hydroperoxy-4-hydroxy-3,7-dimethylocta-2,7-dienoxy]-5-methylchromen-2-one |
| SMILES | C=C(C)[C@H](C[C@H](O)C(C)=CCOc1cc(=O)oc2cccc(C)c12)OO |
| InChI | InChI=1S/C20H24O6/c1-12(2)17(26-23)10-15(21)13(3)8-9-24-18-11-19(22)25-16-7-5-6-14(4)20(16)18/h5-8,11,15,17,21,23H,1,9-10H2,2-4H3/t15-,17-/m0/s1 |
| InChIKey | NKPVHABUNKIXAV-RDJZCZTQSA-N |
| XLogP | 3.61 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|