C18H22O2 — CID 163030210
6,11-dimethylhexadeca-3,5,7,9,11,13-hexaene-2,15-dione (PubChem CID 163030210) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 6,11-dimethylhexadeca-3,5,7,9,11,13-hexaene-2,15-dione.
| Compound Name | 6,11-dimethylhexadeca-3,5,7,9,11,13-hexaene-2,15-dione |
|---|---|
| PubChem CID | 163030210 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 6,11-dimethylhexadeca-3,5,7,9,11,13-hexaene-2,15-dione |
| SMILES | CC(=O)C=CC=C(C)C=CC=CC(C)=CC=CC(C)=O |
| InChI | InChI=1S/C18H22O2/c1-15(11-7-13-17(3)19)9-5-6-10-16(2)12-8-14-18(4)20/h5-14H,1-4H3 |
| InChIKey | QZHDVYDCBCWFDS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|