C19H22O3 — CID 163030346
(3S)-2,2-dimethyl-5-(2-phenylethyl)-3,4-dihydrochromene-3,7-diol (PubChem CID 163030346) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-5-(2-phenylethyl)-3,4-dihydrochromene-3,7-diol.
| Compound Name | (3S)-2,2-dimethyl-5-(2-phenylethyl)-3,4-dihydrochromene-3,7-diol |
|---|---|
| PubChem CID | 163030346 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3S)-2,2-dimethyl-5-(2-phenylethyl)-3,4-dihydrochromene-3,7-diol |
| SMILES | CC1(C)Oc2cc(O)cc(CCc3ccccc3)c2C[C@@H]1O |
| InChI | InChI=1S/C19H22O3/c1-19(2)18(21)12-16-14(10-15(20)11-17(16)22-19)9-8-13-6-4-3-5-7-13/h3-7,10-11,18,20-21H,8-9,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | OPSZZSNWNPEPMW-SFHVURJKSA-N |
| XLogP | 3.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |