C27H41NO2 — CID 163030383
(3S)-6-[(1R)-1-[(3S,8R,9R,10S,13S,14R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-3-methyl-3,5-dihydro-2H-pyridin-4-one (PubChem CID 163030383) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is (3S)-6-[(1R)-1-[(3S,8R,9R,10S,13S,14R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-3-methyl-3,5-dihydro-2H-pyridin-4-one.
| Compound Name | (3S)-6-[(1R)-1-[(3S,8R,9R,10S,13S,14R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-3-methyl-3,5-dihydro-2H-pyridin-4-one |
|---|---|
| PubChem CID | 163030383 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (3S)-6-[(1R)-1-[(3S,8R,9R,10S,13S,14R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-3-methyl-3,5-dihydro-2H-pyridin-4-one |
| SMILES | C[C@H]1CN=C([C@H](C)[C@@H]2CC[C@@H]3[C@H]4CC=C5C[C@@H](O)CC[C@@]5(C)[C@@H]4CC[C@@]32C)CC1=O |
| InChI | InChI=1S/C27H41NO2/c1-16-15-28-24(14-25(16)30)17(2)21-7-8-22-20-6-5-18-13-19(29)9-11-26(18,3)23(20)10-12-27(21,22)4/h5,16-17,19-23,29H,6-15H2,1-4H3/t16-,17+,19-,20+,21-,22+,23+,26+,27+/m0/s1 |
| InChIKey | SSNUZXQLURLLKP-QNWUJLPBSA-N |
| XLogP | 5.61 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|