C21H28O7 — CID 163030626
(3R,4S,5R,7R,8R,13S,16S,19R,22R)-3,7,8-trihydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1(21),10-dien-14-one (PubChem CID 163030626) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is (3R,4S,5R,7R,8R,13S,16S,19R,22R)-3,7,8-trihydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1(21),10-dien-14-one.
| Compound Name | (3R,4S,5R,7R,8R,13S,16S,19R,22R)-3,7,8-trihydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1(21),10-dien-14-one |
|---|---|
| PubChem CID | 163030626 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (3R,4S,5R,7R,8R,13S,16S,19R,22R)-3,7,8-trihydroxy-5,19-dimethyl-15,18,20-trioxapentacyclo[14.5.1.04,13.05,10.019,22]docosa-1(21),10-dien-14-one |
| SMILES | C[C@]12OC=C3C[C@@H](O)[C@H]4[C@H](CC=C5C[C@@H](O)[C@H](O)C[C@@]54C)C(=O)O[C@H](CO1)[C@@H]32 |
| InChI | InChI=1S/C21H28O7/c1-20-7-15(24)13(22)6-11(20)3-4-12-18(20)14(23)5-10-8-26-21(2)17(10)16(9-27-21)28-19(12)25/h3,8,12-18,22-24H,4-7,9H2,1-2H3/t12-,13+,14+,15+,16+,17+,18+,20-,21-/m0/s1 |
| InChIKey | SONAIOSMRQGHMC-IIXQLXHFSA-N |
| XLogP | 1.02 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|