C23H28O8 — CID 163030784
[(4S,6E,8R,10E,11aR)-8-acetyloxy-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-4-yl] 2-methylprop-2-enoate (PubChem CID 163030784) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is [(4S,6E,8R,10E,11aR)-8-acetyloxy-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(4S,6E,8R,10E,11aR)-8-acetyloxy-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163030784 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(4S,6E,8R,10E,11aR)-8-acetyloxy-3-(acetyloxymethyl)-6,10-dimethyl-2-oxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1C/C(C)=C/[C@H](OC(C)=O)C/C(C)=C/[C@H]2OC(=O)C(COC(C)=O)=C12 |
| InChI | InChI=1S/C23H28O8/c1-12(2)22(26)30-19-9-13(3)7-17(29-16(6)25)8-14(4)10-20-21(19)18(23(27)31-20)11-28-15(5)24/h7,10,17,19-20H,1,8-9,11H2,2-6H3/b13-7+,14-10+/t17-,19-,20+/m0/s1 |
| InChIKey | AFMOMFJUJHAVCE-AAPHPHHASA-N |
| XLogP | 2.88 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|