C21H32O6 — CID 163030789
methyl 2-[(1R,3R,6S,8S,11S,12E,15S)-11-hydroperoxy-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-12-en-3-yl]prop-2-enoate (PubChem CID 163030789) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl 2-[(1R,3R,6S,8S,11S,12E,15S)-11-hydroperoxy-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-12-en-3-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1R,3R,6S,8S,11S,12E,15S)-11-hydroperoxy-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-12-en-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163030789 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl 2-[(1R,3R,6S,8S,11S,12E,15S)-11-hydroperoxy-6,11,15-trimethyl-7,16-dioxatricyclo[13.1.0.06,8]hexadec-12-en-3-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@]2(C)O[C@H]2CC[C@](C)(OO)/C=C/C[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C21H32O6/c1-14(18(22)24-5)15-7-12-21(4)16(25-21)8-11-19(2,27-23)9-6-10-20(3)17(13-15)26-20/h6,9,15-17,23H,1,7-8,10-13H2,2-5H3/b9-6+/t15-,16+,17-,19-,20+,21+/m1/s1 |
| InChIKey | BFAFHXDINGOVQJ-CZNDBFSFSA-N |
| XLogP | 3.81 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|