C20H22O4 — CID 163030995
7-(3,7-dimethylocta-2,5,7-trienoxy)-8-methoxychromen-2-one (PubChem CID 163030995) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 7-(3,7-dimethylocta-2,5,7-trienoxy)-8-methoxychromen-2-one.
| Compound Name | 7-(3,7-dimethylocta-2,5,7-trienoxy)-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 163030995 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 7-(3,7-dimethylocta-2,5,7-trienoxy)-8-methoxychromen-2-one |
| SMILES | C=C(C)C=CCC(C)=CCOc1ccc2ccc(=O)oc2c1OC |
| InChI | InChI=1S/C20H22O4/c1-14(2)6-5-7-15(3)12-13-23-17-10-8-16-9-11-18(21)24-19(16)20(17)22-4/h5-6,8-12H,1,7,13H2,2-4H3 |
| InChIKey | XTIGDZABYWOAHX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|