About 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol
2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol (PubChem CID 163031437) has the molecular formula C19H22O3
and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol |
| PubChem CID | 163031437 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol |
| SMILES | CC1(C)O[C@@H]1Cc1c(O)cc(CCc2ccccc2)cc1O |
| InChI | InChI=1S/C19H22O3/c1-19(2)18(22-19)12-15-16(20)10-14(11-17(15)21)9-8-13-6-4-3-5-7-13/h3-7,10-11,18,20-21H,8-9,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | KOXIWQGJNSDVNL-GOSISDBHSA-N |
| XLogP | 3.60 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol?
The IUPAC name of 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol (CID 163031437) is 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol.
What is the SMILES notation for 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol?
The canonical SMILES for 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol is CC1(C)O[C@@H]1Cc1c(O)cc(CCc2ccccc2)cc1O.
What is the InChIKey of 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol?
The InChIKey is KOXIWQGJNSDVNL-GOSISDBHSA-N. The full InChI is InChI=1S/C19H22O3/c1-19(2)18(22-19)12-15-16(20)10-14(11-17(15)21)9-8-13-6-4-3-5-7-13/h3-7,10-11,18,20-21H,8-9,12H2,1-2H3/t18-/m1/s1.
What are the key properties of 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol?
2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol has a molecular weight of 298.38 g/mol, XLogP of 3.60, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-3,3-dimethyloxiran-2-yl]methyl]-5-(2-phenylethyl)benzene-1,3-diol is sourced from PubChem (CID 163031437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).