C20H26O7 — CID 163031822
4-hydroxy-10-(2-methylbutanoyloxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid (PubChem CID 163031822) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 4-hydroxy-10-(2-methylbutanoyloxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid.
| Compound Name | 4-hydroxy-10-(2-methylbutanoyloxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid |
|---|---|
| PubChem CID | 163031822 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-hydroxy-10-(2-methylbutanoyloxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylic acid |
| SMILES | C=C1C(=O)OC2C=C(COC(=O)C(C)CC)CCC=C(C(=O)O)CC(O)C12 |
| InChI | InChI=1S/C20H26O7/c1-4-11(2)19(24)26-10-13-6-5-7-14(18(22)23)9-15(21)17-12(3)20(25)27-16(17)8-13/h7-8,11,15-17,21H,3-6,9-10H2,1-2H3,(H,22,23) |
| InChIKey | KBGAPLZZEILVQG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|