C26H30O10 — CID 163032412
7-(furan-3-yl)-18,20-dihydroxy-20-methoxy-1,12,17,17-tetramethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,19-trione (PubChem CID 163032412) has the molecular formula C26H30O10 and a molecular weight of 502.52 g/mol. Its IUPAC name is 7-(furan-3-yl)-18,20-dihydroxy-20-methoxy-1,12,17,17-tetramethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,19-trione.
| Compound Name | 7-(furan-3-yl)-18,20-dihydroxy-20-methoxy-1,12,17,17-tetramethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,19-trione |
|---|---|
| PubChem CID | 163032412 |
| Molecular Formula | C26H30O10 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 7-(furan-3-yl)-18,20-dihydroxy-20-methoxy-1,12,17,17-tetramethyl-3,6,16-trioxapentacyclo[9.9.0.02,4.02,8.012,18]icos-13-ene-5,15,19-trione |
| SMILES | COC1(O)C(=O)C2(O)C(C)(C)OC(=O)C=CC2(C)C2CCC3C(c4ccoc4)OC(=O)C4OC43C21C |
| InChI | InChI=1S/C26H30O10/c1-21(2)25(30)20(29)26(31,32-5)23(4)15(22(25,3)10-8-16(27)35-21)7-6-14-17(13-9-11-33-12-13)34-19(28)18-24(14,23)36-18/h8-12,14-15,17-18,30-31H,6-7H2,1-5H3 |
| InChIKey | ZVZXGNVPVIFMST-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 145.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|