C30H46O6 — CID 163032724
4,4,10,13,14-pentamethyl-17-(5,6,7-trihydroxy-6-methylheptan-2-yl)-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7,11-trione (PubChem CID 163032724) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is 4,4,10,13,14-pentamethyl-17-(5,6,7-trihydroxy-6-methylheptan-2-yl)-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7,11-trione.
| Compound Name | 4,4,10,13,14-pentamethyl-17-(5,6,7-trihydroxy-6-methylheptan-2-yl)-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7,11-trione |
|---|---|
| PubChem CID | 163032724 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 4,4,10,13,14-pentamethyl-17-(5,6,7-trihydroxy-6-methylheptan-2-yl)-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthrene-3,7,11-trione |
| SMILES | CC(CCC(O)C(C)(O)CO)C1CCC2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3=O |
| InChI | InChI=1S/C30H46O6/c1-17(8-9-23(35)30(7,36)16-31)18-10-13-28(5)25-19(32)14-21-26(2,3)22(34)11-12-27(21,4)24(25)20(33)15-29(18,28)6/h17-18,21,23,31,35-36H,8-16H2,1-7H3 |
| InChIKey | KMGVFINWVGRNJX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |