C26H36O6 — CID 163032956
[8a-hydroxy-3,4a,5-trimethyl-9-(2-methylbut-2-enoyloxy)-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl] 3-methylpent-2-enoate (PubChem CID 163032956) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is [8a-hydroxy-3,4a,5-trimethyl-9-(2-methylbut-2-enoyloxy)-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl] 3-methylpent-2-enoate.
| Compound Name | [8a-hydroxy-3,4a,5-trimethyl-9-(2-methylbut-2-enoyloxy)-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl] 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 163032956 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [8a-hydroxy-3,4a,5-trimethyl-9-(2-methylbut-2-enoyloxy)-4,5,6,7,8,9-hexahydrobenzo[f][1]benzofuran-4-yl] 3-methylpent-2-enoate |
| SMILES | CC=C(C)C(=O)OC1c2occ(C)c2C(OC(=O)C=C(C)CC)C2(C)C(C)CCCC12O |
| InChI | InChI=1S/C26H36O6/c1-8-15(3)13-19(27)31-22-20-17(5)14-30-21(20)23(32-24(28)16(4)9-2)26(29)12-10-11-18(6)25(22,26)7/h9,13-14,18,22-23,29H,8,10-12H2,1-7H3 |
| InChIKey | QNMUZAQJQVDJPL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|