C15H24O4 — CID 163033176
[(Z,4R)-1-[(2S,3R)-3-methyl-5-oxooxolan-2-yl]oct-2-en-4-yl] acetate (PubChem CID 163033176) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [(Z,4R)-1-[(2S,3R)-3-methyl-5-oxooxolan-2-yl]oct-2-en-4-yl] acetate.
| Compound Name | [(Z,4R)-1-[(2S,3R)-3-methyl-5-oxooxolan-2-yl]oct-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 163033176 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [(Z,4R)-1-[(2S,3R)-3-methyl-5-oxooxolan-2-yl]oct-2-en-4-yl] acetate |
| SMILES | CCCC[C@H](/C=C\C[C@@H]1OC(=O)C[C@H]1C)OC(C)=O |
| InChI | InChI=1S/C15H24O4/c1-4-5-7-13(18-12(3)16)8-6-9-14-11(2)10-15(17)19-14/h6,8,11,13-14H,4-5,7,9-10H2,1-3H3/b8-6-/t11-,13-,14+/m1/s1 |
| InChIKey | FZGIAQXFGBDFII-KFJIWYCHSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|