About CID 163033387
CID 163033387 (PubChem CID 163033387) has the molecular formula C49H62N2O13
and a molecular weight of 887.04 g/mol.
Molecular Properties
| Compound Name | CID 163033387 |
| PubChem CID | 163033387 |
| Molecular Formula | C49H62N2O13 |
| Molecular Weight | 887.04 g/mol |
| Exact Mass | 886.43 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC89CCCC8NNC5(C9)C76)C5(CCCCC5)O4)C(O)C3O)c2c1O |
| InChI | InChI=1S/C49H62N2O13/c1-24-35(25(2)54)39(56)36-28(38(24)55)16-26(43(59)60)17-32(36)62-44-40(57)42(58)49(34(20-53)63-44)19-31-37-29(9-10-30(37)47(64-49)13-4-3-5-14-47)46(12-7-15-52)23-61-21-27-18-45-11-6-8-33(45)50-51-48(31,22-45)41(27)46/h9,16-17,27,31,33-34,40-42,44,50-53,55-58H,3-8,10-15,18-23H2,1-2H3,(H,59,60) |
| InChIKey | YLDVUGUCWSWVSS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 887.04 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 163033387 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163033387?
The IUPAC name of CID 163033387 (CID 163033387) is not available.
What is the SMILES notation for CID 163033387?
The canonical SMILES for CID 163033387 is CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC89CCCC8NNC5(C9)C76)C5(CCCCC5)O4)C(O)C3O)c2c1O.
What is the InChIKey of CID 163033387?
The InChIKey is YLDVUGUCWSWVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H62N2O13/c1-24-35(25(2)54)39(56)36-28(38(24)55)16-26(43(59)60)17-32(36)62-44-40(57)42(58)49(34(20-53)63-44)19-31-37-29(9-10-30(37)47(64-49)13-4-3-5-14-47)46(12-7-15-52)23-61-21-27-18-45-11-6-8-33(45)50-51-48(31,22-45)41(27)46/h9,16-17,27,31,33-34,40-42,44,50-53,55-58H,3-8,10-15,18-23H2,1-2H3,(H,59,60).
What are the key properties of CID 163033387?
CID 163033387 has a molecular weight of 887.04 g/mol, XLogP of 4.60, 8 rotatable bonds, 9 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163033387 is sourced from PubChem (CID 163033387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).