C15H24O9 — CID 163033671
(2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[[(1S,2S,4S,6S,10S)-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]decan-10-yl]oxy]oxane-3,4,5-triol (PubChem CID 163033671) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[[(1S,2S,4S,6S,10S)-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]decan-10-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[[(1S,2S,4S,6S,10S)-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]decan-10-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163033671 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-(hydroxymethyl)-6-[[(1S,2S,4S,6S,10S)-2-(hydroxymethyl)-3,9-dioxatricyclo[4.4.0.02,4]decan-10-yl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@H](O[C@@H]2OCC[C@H]3C[C@@H]4O[C@]4(CO)[C@H]32)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24O9/c16-4-7-10(18)11(19)12(20)14(22-7)23-13-9-6(1-2-21-13)3-8-15(9,5-17)24-8/h6-14,16-20H,1-5H2/t6-,7-,8-,9+,10-,11+,12-,13-,14+,15-/m0/s1 |
| InChIKey | BESOZFUJSSJTTH-GVXOYALVSA-N |
| XLogP | -2.68 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|