C8H18O4 — CID 163034122
(3R,5S)-3-(hydroxymethyl)-2-methylhexane-2,3,5-triol (PubChem CID 163034122) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is (3R,5S)-3-(hydroxymethyl)-2-methylhexane-2,3,5-triol.
| Compound Name | (3R,5S)-3-(hydroxymethyl)-2-methylhexane-2,3,5-triol |
|---|---|
| PubChem CID | 163034122 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (3R,5S)-3-(hydroxymethyl)-2-methylhexane-2,3,5-triol |
| SMILES | C[C@H](O)C[C@@](O)(CO)C(C)(C)O |
| InChI | InChI=1S/C8H18O4/c1-6(10)4-8(12,5-9)7(2,3)11/h6,9-12H,4-5H2,1-3H3/t6-,8+/m0/s1 |
| InChIKey | JQANTEBQUAHHPL-POYBYMJQSA-N |
| XLogP | -0.75 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |