C29H36O10 — CID 163034190
[(1'R,2R,3'S,4S,5'S,7'S,8'S,9'S,13'R)-2,7',9',13'-tetrahydroxy-8',11',14',14'-tetramethyl-16'-oxo-2-phenylspiro[1,3-dioxolane-4,4'-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-ene]-5'-yl] acetate (PubChem CID 163034190) has the molecular formula C29H36O10 and a molecular weight of 544.60 g/mol. Its IUPAC name is [(1'R,2R,3'S,4S,5'S,7'S,8'S,9'S,13'R)-2,7',9',13'-tetrahydroxy-8',11',14',14'-tetramethyl-16'-oxo-2-phenylspiro[1,3-dioxolane-4,4'-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-ene]-5'-yl] acetate.
| Compound Name | [(1'R,2R,3'S,4S,5'S,7'S,8'S,9'S,13'R)-2,7',9',13'-tetrahydroxy-8',11',14',14'-tetramethyl-16'-oxo-2-phenylspiro[1,3-dioxolane-4,4'-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-ene]-5'-yl] acetate |
|---|---|
| PubChem CID | 163034190 |
| Molecular Formula | C29H36O10 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(1'R,2R,3'S,4S,5'S,7'S,8'S,9'S,13'R)-2,7',9',13'-tetrahydroxy-8',11',14',14'-tetramethyl-16'-oxo-2-phenylspiro[1,3-dioxolane-4,4'-15-oxatetracyclo[7.4.3.01,10.03,8]hexadec-10-ene]-5'-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@]2(C)[C@H](C[C@@]34C(=C(C)C[C@H]3O)[C@@]2(O)C(=O)OC4(C)C)[C@]12CO[C@](O)(c1ccccc1)O2 |
| InChI | InChI=1S/C29H36O10/c1-15-11-20(32)26-13-18-25(5,28(34,22(15)26)23(33)38-24(26,3)4)19(31)12-21(37-16(2)30)27(18)14-36-29(35,39-27)17-9-7-6-8-10-17/h6-10,18-21,31-32,34-35H,11-14H2,1-5H3/t18-,19-,20+,21-,25-,26-,27+,28+,29+/m0/s1 |
| InChIKey | HUTZTHVUMOQYSI-WXYLMNSJSA-N |
| XLogP | 1.43 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|