About [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate
[5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate (PubChem CID 163034233) has the molecular formula C24H24O7
and a molecular weight of 424.45 g/mol. Its IUPAC name is [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate.
Molecular Properties
| Compound Name | [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate |
| PubChem CID | 163034233 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate |
| SMILES | COc1ccc2c(=O)cc(-c3ccccc3)oc2c1C1C(O)OC(C)(C)C1OC(C)=O |
| InChI | InChI=1S/C24H24O7/c1-13(25)29-22-20(23(27)31-24(22,2)3)19-17(28-4)11-10-15-16(26)12-18(30-21(15)19)14-8-6-5-7-9-14/h5-12,20,22-23,27H,1-4H3 |
| InChIKey | LQFYRSWYFPDEHM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate?
The IUPAC name of [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate (CID 163034233) is [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate.
What is the SMILES notation for [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate?
The canonical SMILES for [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate is COc1ccc2c(=O)cc(-c3ccccc3)oc2c1C1C(O)OC(C)(C)C1OC(C)=O.
What is the InChIKey of [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate?
The InChIKey is LQFYRSWYFPDEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O7/c1-13(25)29-22-20(23(27)31-24(22,2)3)19-17(28-4)11-10-15-16(26)12-18(30-21(15)19)14-8-6-5-7-9-14/h5-12,20,22-23,27H,1-4H3.
What are the key properties of [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate?
[5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate has a molecular weight of 424.45 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-hydroxy-4-(7-methoxy-4-oxo-2-phenylchromen-8-yl)-2,2-dimethyloxolan-3-yl] acetate is sourced from PubChem (CID 163034233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).