C10H16 — CID 163034296
(1R,2R,5S,7R)-6,6,7-trimethyltricyclo[3.2.0.02,7]heptane (PubChem CID 163034296) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (1R,2R,5S,7R)-6,6,7-trimethyltricyclo[3.2.0.02,7]heptane.
| Compound Name | (1R,2R,5S,7R)-6,6,7-trimethyltricyclo[3.2.0.02,7]heptane |
|---|---|
| PubChem CID | 163034296 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (1R,2R,5S,7R)-6,6,7-trimethyltricyclo[3.2.0.02,7]heptane |
| SMILES | CC1(C)[C@H]2CC[C@@H]3[C@H]2[C@@]31C |
| InChI | InChI=1S/C10H16/c1-9(2)6-4-5-7-8(6)10(7,9)3/h6-8H,4-5H2,1-3H3/t6-,7+,8-,10+/m0/s1 |
| InChIKey | WMLCBYLGIDOUMQ-PYHGXSLLSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |