C26H42O6 — CID 163034872
[6-(1-hydroxypropan-2-yl)-4,4a-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-1-yl] 2-hydroxy-2-(hydroxymethyl)-4,6-dimethyloctanoate (PubChem CID 163034872) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is [6-(1-hydroxypropan-2-yl)-4,4a-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-1-yl] 2-hydroxy-2-(hydroxymethyl)-4,6-dimethyloctanoate.
| Compound Name | [6-(1-hydroxypropan-2-yl)-4,4a-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-1-yl] 2-hydroxy-2-(hydroxymethyl)-4,6-dimethyloctanoate |
|---|---|
| PubChem CID | 163034872 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | [6-(1-hydroxypropan-2-yl)-4,4a-dimethyl-7-oxo-1,2,3,4-tetrahydronaphthalen-1-yl] 2-hydroxy-2-(hydroxymethyl)-4,6-dimethyloctanoate |
| SMILES | CCC(C)CC(C)CC(O)(CO)C(=O)OC1CCC(C)C2(C)C=C(C(C)CO)C(=O)C=C12 |
| InChI | InChI=1S/C26H42O6/c1-7-16(2)10-17(3)12-26(31,15-28)24(30)32-23-9-8-19(5)25(6)13-20(18(4)14-27)22(29)11-21(23)25/h11,13,16-19,23,27-28,31H,7-10,12,14-15H2,1-6H3 |
| InChIKey | BGVIFZCMSUQDTG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |