C22H32O3 — CID 163034991
(1R,5R,6R)-5-hydroxy-4-methyl-1-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 163034991) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (1R,5R,6R)-5-hydroxy-4-methyl-1-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5R,6R)-5-hydroxy-4-methyl-1-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 163034991 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (1R,5R,6R)-5-hydroxy-4-methyl-1-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)=CC[C@@]12O[C@@H]1[C@H](O)C(C)=CC2=O |
| InChI | InChI=1S/C22H32O3/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-19(23)14-18(5)20(24)21(22)25-22/h8,10,12,14,20-21,24H,6-7,9,11,13H2,1-5H3/b16-10+,17-12?/t20-,21-,22+/m1/s1 |
| InChIKey | DKOXVDVXOYHFHV-SBLOXOGRSA-N |
| XLogP | 4.82 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|