C15H18O6 — CID 163035135
(2Z)-2-[3-hydroxy-4-[(E,4R)-4-methyloct-2-enoyl]-5-oxofuran-2-ylidene]acetic acid (PubChem CID 163035135) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (2Z)-2-[3-hydroxy-4-[(E,4R)-4-methyloct-2-enoyl]-5-oxofuran-2-ylidene]acetic acid.
| Compound Name | (2Z)-2-[3-hydroxy-4-[(E,4R)-4-methyloct-2-enoyl]-5-oxofuran-2-ylidene]acetic acid |
|---|---|
| PubChem CID | 163035135 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2Z)-2-[3-hydroxy-4-[(E,4R)-4-methyloct-2-enoyl]-5-oxofuran-2-ylidene]acetic acid |
| SMILES | CCCC[C@@H](C)/C=C/C(=O)C1=C(O)/C(=C/C(=O)O)OC1=O |
| InChI | InChI=1S/C15H18O6/c1-3-4-5-9(2)6-7-10(16)13-14(19)11(8-12(17)18)21-15(13)20/h6-9,19H,3-5H2,1-2H3,(H,17,18)/b7-6+,11-8-/t9-/m1/s1 |
| InChIKey | DPHXIYPTUGEXJY-MRPWLJHASA-N |
| XLogP | 2.28 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|