About benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate
benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 163035481) has the molecular formula C19H17NO4
and a molecular weight of 323.35 g/mol. Its IUPAC name is benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate.
Molecular Properties
| Compound Name | benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| PubChem CID | 163035481 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)[C@@H]1CN2C(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C19H17NO4/c21-16-11-17-20(16)12-15(23-17)19(22)24-18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17-18H,11-12H2/t15-,17-/m0/s1 |
| InChIKey | CEEBXOCAKPHCTA-RDJZCZTQSA-N |
| XLogP | 2.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate?
The IUPAC name of benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate (CID 163035481) is benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate.
What is the SMILES notation for benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate?
The canonical SMILES for benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate is O=C(OC(c1ccccc1)c1ccccc1)[C@@H]1CN2C(=O)C[C@@H]2O1.
What is the InChIKey of benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate?
The InChIKey is CEEBXOCAKPHCTA-RDJZCZTQSA-N. The full InChI is InChI=1S/C19H17NO4/c21-16-11-17-20(16)12-15(23-17)19(22)24-18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15,17-18H,11-12H2/t15-,17-/m0/s1.
What are the key properties of benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate?
benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate has a molecular weight of 323.35 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl (3S,5S)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-3-carboxylate is sourced from PubChem (CID 163035481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).