C27H48O2 — CID 163035724
(E,4R,5S,8R,12S)-5-hydroxy-4,8,12-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)pentadec-1-en-7-one (PubChem CID 163035724) has the molecular formula C27H48O2 and a molecular weight of 404.68 g/mol. Its IUPAC name is (E,4R,5S,8R,12S)-5-hydroxy-4,8,12-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)pentadec-1-en-7-one.
| Compound Name | (E,4R,5S,8R,12S)-5-hydroxy-4,8,12-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)pentadec-1-en-7-one |
|---|---|
| PubChem CID | 163035724 |
| Molecular Formula | C27H48O2 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.37 |
| IUPAC Name | (E,4R,5S,8R,12S)-5-hydroxy-4,8,12-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)pentadec-1-en-7-one |
| SMILES | CCC[C@H](C)CCC[C@@H](C)C(=O)C[C@H](O)[C@H](C)C/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C27H48O2/c1-8-12-20(2)13-9-14-22(4)25(28)19-26(29)23(5)15-10-17-24-21(3)16-11-18-27(24,6)7/h10,17,20,22-23,26,29H,8-9,11-16,18-19H2,1-7H3/b17-10+/t20-,22+,23+,26-/m0/s1 |
| InChIKey | JSSNFOHEHRIBDT-YVFVYJCDSA-N |
| XLogP | 7.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |