C42H54O6 — CID 163035951
[6-[18-(2,4-dihydroxy-2,6,6-trimethylcyclohexylidene)-3-formyl-7,12,16-trimethyloctadeca-3,5,7,9,11,13,15,17-octaen-1-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate (PubChem CID 163035951) has the molecular formula C42H54O6 and a molecular weight of 654.89 g/mol. Its IUPAC name is [6-[18-(2,4-dihydroxy-2,6,6-trimethylcyclohexylidene)-3-formyl-7,12,16-trimethyloctadeca-3,5,7,9,11,13,15,17-octaen-1-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate.
| Compound Name | [6-[18-(2,4-dihydroxy-2,6,6-trimethylcyclohexylidene)-3-formyl-7,12,16-trimethyloctadeca-3,5,7,9,11,13,15,17-octaen-1-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate |
|---|---|
| PubChem CID | 163035951 |
| Molecular Formula | C42H54O6 |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.39 |
| IUPAC Name | [6-[18-(2,4-dihydroxy-2,6,6-trimethylcyclohexylidene)-3-formyl-7,12,16-trimethyloctadeca-3,5,7,9,11,13,15,17-octaen-1-ynyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(C)C2(C#CC(C=O)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=C=C3C(C)(C)CC(O)CC3(C)O)OC2(C)C1 |
| InChI | InChI=1S/C42H54O6/c1-30(17-13-18-32(3)21-22-37-38(5,6)25-35(45)26-40(37,9)46)15-11-12-16-31(2)19-14-20-34(29-43)23-24-42-39(7,8)27-36(47-33(4)44)28-41(42,10)48-42/h11-21,29,35-36,45-46H,25-28H2,1-10H3 |
| InChIKey | PRMVHLYTIYMENC-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|