C17H20O9 — CID 163036030
(5,9-dihydroxy-4,13-dimethyl-3,8-dioxo-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadec-13-en-16-yl) acetate (PubChem CID 163036030) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is (5,9-dihydroxy-4,13-dimethyl-3,8-dioxo-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadec-13-en-16-yl) acetate.
| Compound Name | (5,9-dihydroxy-4,13-dimethyl-3,8-dioxo-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadec-13-en-16-yl) acetate |
|---|---|
| PubChem CID | 163036030 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (5,9-dihydroxy-4,13-dimethyl-3,8-dioxo-2,7,15-trioxatetracyclo[10.2.1.16,9.01,5]hexadec-13-en-16-yl) acetate |
| SMILES | CC(=O)OC1C2OC(=O)C1(O)CCC1OC3(C=C1C)OC(=O)C(C)C23O |
| InChI | InChI=1S/C17H20O9/c1-7-6-16-17(22,8(2)13(19)26-16)12-11(23-9(3)18)15(21,14(20)24-12)5-4-10(7)25-16/h6,8,10-12,21-22H,4-5H2,1-3H3 |
| InChIKey | SOZLJWBOQDILOM-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|